
Справочник действующих веществ



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0


РЕГИСТРАЦИОННЫЙ НОМЕР CAS - 58594-72-2 МОЛЕКУЛЯРНАЯ ФОРМУЛА - C14H16CL2N2O5S INCHI - INCHI=1S/C14H14CL2N2O.H2O4S/C1-2-7-19-14(9-18-6-5-17-10-18)12-4 ...

Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0



Рейтинг: 0